1. conbosua_lonton

    conbosua_lonton Th.Viên Premium

    Bài viết:
    Đã được thích:
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][U][I][COLOR=#ff0000]MỘT [/COLOR][COLOR=#0000ff]CHỮ [/COLOR][COLOR=#ff0000]TÍN---VẠN [/COLOR][COLOR=#0000ff]NIỀM[/COLOR][COLOR=#ff0000] TIN[/COLOR][/I][/U][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]

    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]Sky a890[B][B][B][B] ..........BrandNew 100%.......7t3[/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B] hot002-1.gif
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]Sky a870[B][B][B][B] .......BrandNew 100%.....5tr499[/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B] hot002-1.gif

    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][COLOR=#00b300]Sky a830 [/COLOR][B][B][B][B][COLOR=#00b300]....... BrandNew100%.........2tr899[/COLOR][B][COLOR=rgb(255, 0, 0)][IMG][url]http://i450.photobucket.com/albums/qq227/EDISON1512/hot002-1.gif[/url][/IMG][/COLOR][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]

    G2 Docomo.....BrandNew 100%......6t299[​IMG]

    Sky 870 .....Brandnew 100% ......5t499[​IMG]
    Sony Z......Brandnew 100%.......5tr999[​IMG]

    Sony Z1....likenew 99%.......6tr299[​IMG]
    Galaxy J .....Brandnew 100% ......6tr290[​IMG]
    LG Optimus Vu 2...Brandnew 100% ...3tr499[​IMG]
    LG G PRO .....Brandnew 100% ......5tr950[​IMG]




    [​IMG] Zenfone [​IMG]
    Zenfone 5 (A501 - RAM 1GB) Giá 3tr1 VNĐ New 100%

    Zenfone 5 (A501 - RAM 2GB) Giá 3tr5 VNĐ New 100%
    Zenfone 5 (A500 - RAM 2GB) Giá 3tr7 VNĐ New 100%


    Zenfone 6 - 8gb Giá 4tr5 VNĐ New 100%
    Zenfone 6 - 16gb Giá 4tr9 VNĐ New 100%


    [​IMG]Hiện nay trên thị trường có nhiều nơi nhập hàng từ Móng Cái (TQ) về. Máy bán ra thường rẻ hơn so với thị trường từ 300K -> 500K nhưng chất lượng rất kém vì hầu như hàng đã thay vỏ và sửa chữa lại, xài 1 thời gian là bị lỗi.

    Anh em chú ý để lựa chọn cho mình sản phẩm tốt nhất nhé!!!

    [COLOR=#ff0000]MR TIẾN : [/COLOR][COLOR=#0000ff]0938560499[/COLOR]

    Tiến Pro Mobile chuyên kinh doanh điện thoại di động, điện thoại thông minh (smartphone), hàng công nghệ, các loại phụ kiện cao cấp, linh kiện cho điện thoại di động. Mặt hàng thế mạnh của Tiến Pro Mobile đó là dòng điện thoại thông minh SKY Phone, Samsung, Sony, LG, ASUS

    Website: tienpromobile.com
    Facebook: Tiến Pro Mobile


    Khách hàng ở xa muốn mua hàng vui lòng chuyển khoản vào tài khoản ngân hàng. Sau 24h sẽ nhận được hàng nhé!

    TK Vietcombank : 0251002542950
    Chủ tài khoản : Phùng Văn Tiến


    Tiến Pro Mobile hiện có chế độ bảo hành tốt nhất Sài Gòn dành cho khách hàng:

    [B][B][SIZE=5][COLOR=#ff0000]Lưu ý: Mức giá này chỉ áp dụng với chi nhánh Sài Gòn, các chi nhánh khác vui lòng +100k phát sinh theo phí vận chuyển, bảo hành và hỗ trợ khách hàng.[/COLOR][/SIZE][/B][/B]

    Chính Hãng Korea 100%
    Galaxy J .....Brandnew 100% ......6tr290[​IMG]

    Galaxy s2 HD e120 .......LikeNew 99%.....2tr8
    Galaxy Grand (lõi tứ) ..LikeNew 99%....3tr2

    Galaxy R Style ..............LikeNew 99%..................
    Galaxy Grand e270 ........LikeNew 99%..................3tr2
    [COLOR=#ff0000]Galaxy Note 1 ...............LikeNew 99%..................3tr3[/COLOR]
    [B]Galaxy S3 .....................LikeNew 99% .................3tr7[/B]

    Galaxy Note 2 ...............LikeNew 99%..................4tr7
    Galaxy S4 Lte-A e330.....LikeNew 99%..................5tr9

    [B][SIZE=5][COLOR=#ff0000]Galaxy Mega 6.3 ............LikeNew 99%...................
    Galaxy Note 3 N900 .......LikeNew 99%................. 9tr[/COLOR]
    Galaxy S4 Zoom ...............BrandNew 100%................5tr5
    Galaxy S4 E330 GOLD........BrandNew 100%................8tr5[/SIZE][/B]
    [B][B][B]Galaxy POP E220 CAM .......BrandNew 100%................5tr9
    Note 3 GOLD (quay 4K)......BrandNew 100%..............11tr3[/B][/B][/B]

    [B][SIZE=5]Galaxy Round (cong) ........BrandNew 100%.................he[/SIZE][SIZE=3]t[/SIZE][/B]
    [B][B]Galaxy S5 G900 ................BrandNew 100%..............11tr5[/B][/B]

    CHính hãng korea 100%

    [B][COLOR=#ff0000]Giá 1: bao đổi trong 7 ngày đầu sử dụng[/COLOR][/B]
    [B][B][B][COLOR=#0000ff]Giá 2: bao đổi trong 3 tháng đầu sử dụng [/COLOR][/B][/B][/B]
    [B][B][B][B][B][B][B][B][COLOR=#ff0000]Bảo hành 12 tháng[/COLOR]

    [B][B][B][B][B][B][COLOR=#00b300]Tình trạng máy : Nguyên bản đẹp[/COLOR][/B][/B][/B][/B][/B][/B]
    [B][B][B][B][B][B][B][B][COLOR=#00b300]Phụ kiện đi kèm : xạc +cáp +tai nghe[/COLOR][/B][/B][/B][/B][/B][/B][/B][/B]
    [B][B][B][B][B][B][B][B][B][B][COLOR=#00b300]Khuyến mại : Miếng dán màn hình 3 lớp + Cài đặt phần mềm[/COLOR][/B][/B][/B][/B][/B][/B][/B][/B][/B]

    [SIZE=5]Sky 760 like new 99% [/SIZE]
    [B][SIZE=5][COLOR=#ff0000]Giá 1: 1tr499 [/COLOR][/SIZE][/B][/B]

    [B][B][B][B][B][B][B][B][SIZE=5]Giá 2: 1tr699 [/SIZE][/B][/B][/B][/B][/B][/B][/B][/B]
    [B][B][B][B][B][B][B][B][B][B][SIZE=5]Sky 770 like new 99%[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
    [B][B][B][B][B][B][B][B][B][B][SIZE=5][B][B][COLOR=#ff0000]Giá 1: 1tr599[/COLOR][/B][/B][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Giá 2: 1tr799[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Sky 810 ===> like new 99%[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5][COLOR=#ff0000]Giá 1: 1tr899[/COLOR][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Giá 2: 2tr099[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]

    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Sky 820 ===> like new 99%[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5][COLOR=#ff0000]Giá 1: 1tr999[/COLOR][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]Giá 2: 2tr199[/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]

    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Sky 830 ===> like new 99%[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5][COLOR=#ff0000]Giá 1: 2tr150[/COLOR][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Giá 2: 2tr299[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]​
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Sky 840 ===> like new 99%[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5][COLOR=#ff0000]Giá 1: 2tr599[/COLOR][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Giá 2: 2tr899[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Sky 850 ===> like new 99%[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5][COLOR=#ff0000]Giá 1: 3tr199[/COLOR][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Giá 2: 3tr399[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Sky 860 ===> like new 99%[/SIZE]
    [B][B][B][SIZE=5][COLOR=#ff0000]Giá 1: 3tr599[/COLOR][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Giá 2: 3tr899[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Sky 870 ===> like new 99%[/SIZE]
    [B][B][B][SIZE=5][COLOR=#ff0000]Giá 1: 4tr099[/COLOR][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Giá 2: 4tr299[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Sky 880 ===> like new 99%[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5][COLOR=#ff0000]Giá 1: 4tr650[/COLOR]
    Giá 2: 4tr799[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Sky 890 ===> like new 99%[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5][COLOR=#ff0000]Giá 1: 5tr450[/COLOR][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Giá 2: 5tr599[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Sky 900 ===> like new 99%[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5][COLOR=#ff0000]Giá 1: 5tr150[/COLOR][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Giá 2: 5tr299[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5][COLOR=#ff0000]Hàng new 100% [/COLOR][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5][COLOR=#ff0000]Sky a830 ................BrandNew100%...........2tr899[/COLOR][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5][COLOR=#ff0000]Sky a830ke............BrandNew100%......3tr299[/COLOR][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5][COLOR=#ff0000]Sky a840...........BrandNew100%.................4tr2
    Sky a850 ...........BrandNew 100%..................4tr5
    Sky a860 ...............BrandNew 100%..............5tr [/COLOR][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5][COLOR=#ff0000]Sky a870 ...........BrandNew 100%...........5tr499( Just arrive)[/COLOR][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5][COLOR=#ff0000]Sky a880 ............BrandNew 100%.............5tr9 [/COLOR][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5][COLOR=#ff0000]Sky a890 ............BrandNew 100%............6tr9[/COLOR][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5][COLOR=#ff0000]Sky a900 ..................BrandNew 100%..........6tr4[/COLOR]
    Sky a910 ..............BrandNew 100%............10tr2[/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
    [B][B][B][B][B][B][B][B][B][B][B][B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=7][COLOR=#0000ff]LG OPTIMUS
    Chính hãng korea 100%[/COLOR][/SIZE]
    G2Docomo.......BrandNew 100%.........6t299[IMG][url]http://i450.photobucket.com/albums/qq227/EDISON1512/hot002-1.gif[/url][/IMG][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]

    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]Gpro F240...Brandnew 100% ...5t950[IMG][url]http://i450.photobucket.com/albums/qq227/EDISON1512/hot002-1.gif[/url][/IMG][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]

    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]LG Optimus Vu 2...Brandnew 100% ...3tr199[IMG][url]http://i450.photobucket.com/albums/qq227/EDISON1512/hot002-1.gif[/url][/IMG][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER][/SIZE]

    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5][COLOR=#0000b3]LG SU640====>h/thức 99%[/COLOR]
    [COLOR=#ff0000] Giá 1: 1tr899[/COLOR][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [SIZE=5][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]Giá 2: 2tr099

    [B][B][B]LG LU640====>h/thức 99%
    [COLOR=#ff0000]Giá 1: 1tr899[/COLOR][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER][/SIZE][/B]
    [SIZE=5][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][SIZE=5]Giá 2: 2tr099[/SIZE]

    [B]LG Prada 540====>h/thức 99%
    [COLOR=#ff0000]Giá 1: 1tr699[/COLOR]
    Giá 2: 1tr899

    [B]LG VU1 F100====>h/thức 99%
    [COLOR=#ff0000] Giá 1: 2tr099[/COLOR][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]Giá 2: 2tr299

    [B]LG VU2 F200====>h/thức 99% [/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][COLOR=#ff0000]Giá 1: 2tr699[/COLOR][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]Giá 2: 2tr899

    [B]LG VU3 F200====>h/thức 99% [/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]Giá 1: off
    Giá 2: off

    [B]LG LTE2 F160====>h/thức 99%
    [COLOR=#ff0000]Giá 1: 2tr399[/COLOR]
    Giá 2: 2tr699

    [B]LG G F180====>h/thức 99%
    [COLOR=#ff0000]Giá 1: 3tr199[/COLOR][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]Giá 2: 3tr399

    [B]LG GK F220====>h/thức 99%
    [COLOR=#ff0000]Giá 1: 3tr699[/COLOR]
    Giá 2: 3tr899

    [B]LG Gpro F240 ====>h/thức 99%
    [COLOR=#ff0000]Giá 1: 3tr999[/COLOR][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]Giá 2: 4tr199

    [B]LG G2 F320 ====>h/thức 99%
    [COLOR=#ff0000]Giá 1: 5tr199[/COLOR]
    Giá 2: 5tr499
    NEW 100%

    [COLOR=#0000b3]LG KU5900 .................100%.........[/COLOR][COLOR=#ff0000]2tr2[/COLOR][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][COLOR=#0000b3]LG Prada 3.0 ...............100%.........[/COLOR][COLOR=#ff0000]2tr8[/COLOR]
    [COLOR=#0000b3]LG Vu1 f100 ................100%.........[/COLOR][COLOR=#ff0000]2tr8[/COLOR][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][COLOR=#0000b3]LG Vu2 F200 ...............100%.........[/COLOR][COLOR=#ff0000]3tr5[/COLOR]
    [COLOR=#0000b3]LG Optimus G ..............100%..........[/COLOR][COLOR=#ff0000]4tr4[/COLOR][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][COLOR=#0000b3]LG Optimus GK ............100%..........[/COLOR][COLOR=#ff0000]5tr[/COLOR]
    [COLOR=#0000b3]LG Optimus G Pro.........100%..........[/COLOR][COLOR=#ff0000]5tr7[/COLOR]
    [COLOR=#0000b3]LG Optimus GX ............100%..........[/COLOR][COLOR=#ff0000]5tr9[/COLOR][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][COLOR=#0000b3]LG G2 Isai ....................100%..........[/COLOR][COLOR=#ff0000]hết[/COLOR]
    [COLOR=#0000b3]LGVu3 F300 ................100%..........[/COLOR][COLOR=#ff0000]5tr8[/COLOR]
    [COLOR=#0000b3]LG G2 F320..................100%..........[/COLOR][COLOR=#ff0000]7tr5[Mới Vế][/COLOR][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER]
    [B][CENTER][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][COLOR=#0000b3]LG G Flex F340 ............100%..........[/COLOR][COLOR=#ff0000]7tr5[/COLOR]
    [COLOR=#0000b3]LG G PRO 2 F350..........100%..........[/COLOR][COLOR=#ff0000]8tr9[/COLOR]
    [COLOR=#0000b3]LG G3 ...........................100%..........[/COLOR][COLOR=#ff0000]10tr7[/COLOR]
    [COLOR=#0000b3]LG G3 Cat6 ..................100%..........[/COLOR][COLOR=#ff0000]11tr7[/COLOR][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/CENTER][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/SIZE][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]


Đang tải...